Name | 3,4-diethoxyphenylacetic acid |
Synonyms | 3,4-Diethyloxy VITAS-BB TBB000357 ART-CHEM-BB B006522 RARECHEM AL BO 0610 3,4-diethoxyphenylacetic acid 3,4-Diethoxyphenylacetic acid 3,4-diethoxybenzeneacetic acid 3,4-diethoxy phenyl acetic acid 3,4-Diethyloxy Phenyl acetic acid 2-(3,4-diethoxyphenyl)ethanoic acid 2-(3,4-BIS(HYDROXYMETHYL)PHENYL)ACETIC ACID |
CAS | 38464-04-9 |
EINECS | 253-957-3 |
InChI | InChI=1/C12H16O4/c1-3-15-10-6-5-9(8-12(13)14)7-11(10)16-4-2/h5-7H,3-4,8H2,1-2H3,(H,13,14) |
Molecular Formula | C12H16O4 |
Molar Mass | 224.25 |
Density | 1.133±0.06 g/cm3(Predicted) |
Melting Point | 77-79°C |
Boling Point | 357.2±27.0 °C(Predicted) |
Flash Point | 134.1°C |
Vapor Presure | 1.01E-05mmHg at 25°C |
pKa | 4.36±0.10(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.518 |
MDL | MFCD00040785 |
Physical and Chemical Properties | White-like powder. |
Use | Used as a drug intermediate of dritaviline |
Hazard Symbols | Xi - Irritant |
Hazard Class | IRRITANT |
chemical properties | white-like powder. |
use | tritavilin intermediate. Melting point: 75 ℃-85 ℃. used as drug drotaverine intermediate |